C55H130O11Si8 — CID 163486231
3-ethoxypropyl-tris[3-[tris(3-tritiopropyl)silyl]propyl]silane;3-ethoxypropyl-tris(3-tritritiooxysilylpropyl)silane (PubChem CID 163486231) has the molecular formula C55H130O11Si8 and a molecular weight of 1228.47 g/mol. Its IUPAC name is 3-ethoxypropyl-tris[3-[tris(3-tritiopropyl)silyl]propyl]silane;3-ethoxypropyl-tris(3-tritritiooxysilylpropyl)silane.
| Compound Name | 3-ethoxypropyl-tris[3-[tris(3-tritiopropyl)silyl]propyl]silane;3-ethoxypropyl-tris(3-tritritiooxysilylpropyl)silane |
|---|---|
| PubChem CID | 163486231 |
| Molecular Formula | C55H130O11Si8 |
| Molecular Weight | 1228.47 g/mol |
| Exact Mass | 1226.92 |
| IUPAC Name | 3-ethoxypropyl-tris[3-[tris(3-tritiopropyl)silyl]propyl]silane;3-ethoxypropyl-tris(3-tritritiooxysilylpropyl)silane |
| SMILES | [3H]CCC[Si](CCC[3H])(CCC[3H])CCC[Si](CCCOCC)(CCC[Si](CCC[3H])(CCC[3H])CCC[3H])CCC[Si](CCC[3H])(CCC[3H])CCC[3H].[3H]O[Si](CCC[Si](CCCOCC)(CCC[Si](O[3H])(O[3H])O[3H])CCC[Si](O[3H])(O[3H])O[3H])(O[3H])O[3H] |
| InChI | InChI=1S/C41H92OSi4.C14H38O10Si4/c1-11-26-43(27-12-2,28-13-3)36-22-39-46(35-21-25-42-20-10,40-23-37-44(29-14-4,30-15-5)31-16-6)41-24-38-45(32-17-7,33-18-8)34-19-9;1-2-24-7-3-8-25(9-4-12-26(15,16)17,10-5-13-27(18,19)20)11-6-14-28(21,22)23/h11-41H2,1-10H3;15-23H,2-14H2,1H3/i1T,2T,3T,4T,5T,6T,7T,8T,9T;15T,16T,17T,18T,19T,20T,21T,22T,23T |
| InChIKey | CITWAJWXRBLSOC-MGKDRBODSA-N |
| XLogP | 14.85 |
| TPSA | 200.53 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 70 |
| Heavy Atoms | 74 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1228.47 |
| LogP ≤ 5 | 14.85 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|