C13H32O3Si2 — CID 59964542
2-ethoxyethyl-[3-ethoxypropyl(dimethyl)silyl]oxy-dimethylsilane (PubChem CID 59964542) has the molecular formula C13H32O3Si2 and a molecular weight of 292.57 g/mol. Its IUPAC name is 2-ethoxyethyl-[3-ethoxypropyl(dimethyl)silyl]oxy-dimethylsilane.
| Compound Name | 2-ethoxyethyl-[3-ethoxypropyl(dimethyl)silyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 59964542 |
| Molecular Formula | C13H32O3Si2 |
| Molecular Weight | 292.57 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 2-ethoxyethyl-[3-ethoxypropyl(dimethyl)silyl]oxy-dimethylsilane |
| SMILES | CCOCCC[Si](C)(C)O[Si](C)(C)CCOCC |
| InChI | InChI=1S/C13H32O3Si2/c1-7-14-10-9-12-17(3,4)16-18(5,6)13-11-15-8-2/h7-13H2,1-6H3 |
| InChIKey | GKZZYNPGKFRUFD-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.57 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|