C28H74O14Si8 — CID 59593661
tris[dimethyl(2-trimethoxysilylethyl)silyl] [3-ethoxypropyl(dimethyl)silyl] silicate (PubChem CID 59593661) has the molecular formula C28H74O14Si8 and a molecular weight of 859.57 g/mol. Its IUPAC name is tris[dimethyl(2-trimethoxysilylethyl)silyl] [3-ethoxypropyl(dimethyl)silyl] silicate.
| Compound Name | tris[dimethyl(2-trimethoxysilylethyl)silyl] [3-ethoxypropyl(dimethyl)silyl] silicate |
|---|---|
| PubChem CID | 59593661 |
| Molecular Formula | C28H74O14Si8 |
| Molecular Weight | 859.57 g/mol |
| Exact Mass | 858.32 |
| IUPAC Name | tris[dimethyl(2-trimethoxysilylethyl)silyl] [3-ethoxypropyl(dimethyl)silyl] silicate |
| SMILES | CCOCCC[Si](C)(C)O[Si](O[Si](C)(C)CC[Si](OC)(OC)OC)(O[Si](C)(C)CC[Si](OC)(OC)OC)O[Si](C)(C)CC[Si](OC)(OC)OC |
| InChI | InChI=1S/C28H74O14Si8/c1-19-38-21-20-22-43(11,12)39-50(40-44(13,14)23-26-47(29-2,30-3)31-4,41-45(15,16)24-27-48(32-5,33-6)34-7)42-46(17,18)25-28-49(35-8,36-9)37-10/h19-28H2,1-18H3 |
| InChIKey | PMAZYGLDEDPNSD-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 129.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.57 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|