C22H60O7Si5 — CID 160521997
methane;2-methoxy-3-[3-[[2-[methoxy-bis(trimethylsilyloxy)silyl]ethyl-dimethylsilyl]oxy-dimethylsilyl]propoxy]propan-1-ol (PubChem CID 160521997) has the molecular formula C22H60O7Si5 and a molecular weight of 577.15 g/mol. Its IUPAC name is methane;2-methoxy-3-[3-[[2-[methoxy-bis(trimethylsilyloxy)silyl]ethyl-dimethylsilyl]oxy-dimethylsilyl]propoxy]propan-1-ol.
| Compound Name | methane;2-methoxy-3-[3-[[2-[methoxy-bis(trimethylsilyloxy)silyl]ethyl-dimethylsilyl]oxy-dimethylsilyl]propoxy]propan-1-ol |
|---|---|
| PubChem CID | 160521997 |
| Molecular Formula | C22H60O7Si5 |
| Molecular Weight | 577.15 g/mol |
| Exact Mass | 576.32 |
| IUPAC Name | methane;2-methoxy-3-[3-[[2-[methoxy-bis(trimethylsilyloxy)silyl]ethyl-dimethylsilyl]oxy-dimethylsilyl]propoxy]propan-1-ol |
| SMILES | C.C.COC(CO)COCCC[Si](C)(C)O[Si](C)(C)CC[Si](OC)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C20H52O7Si5.2CH4/c1-22-20(18-21)19-24-14-13-15-30(9,10)27-31(11,12)16-17-32(23-2,25-28(3,4)5)26-29(6,7)8;;/h20-21H,13-19H2,1-12H3;2*1H4 |
| InChIKey | QUJYFYNPZRGNIL-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.15 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|