C15H36F2O5Si3 — CID 88551639
3-(2,2-difluoropropoxy)propyl-[dimethyl(2-trimethoxysilylethyl)silyl]oxy-dimethylsilane (PubChem CID 88551639) has the molecular formula C15H36F2O5Si3 and a molecular weight of 418.70 g/mol. Its IUPAC name is 3-(2,2-difluoropropoxy)propyl-[dimethyl(2-trimethoxysilylethyl)silyl]oxy-dimethylsilane.
| Compound Name | 3-(2,2-difluoropropoxy)propyl-[dimethyl(2-trimethoxysilylethyl)silyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 88551639 |
| Molecular Formula | C15H36F2O5Si3 |
| Molecular Weight | 418.70 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 3-(2,2-difluoropropoxy)propyl-[dimethyl(2-trimethoxysilylethyl)silyl]oxy-dimethylsilane |
| SMILES | CO[Si](CC[Si](C)(C)O[Si](C)(C)CCCOCC(C)(F)F)(OC)OC |
| InChI | InChI=1S/C15H36F2O5Si3/c1-15(16,17)14-21-10-9-11-23(5,6)22-24(7,8)12-13-25(18-2,19-3)20-4/h9-14H2,1-8H3 |
| InChIKey | PYKCNJJANQJCMT-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.70 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|