C12H28F2O7Si — CID 91274401
3-(2-fluoroethoxy)propyl-trimethoxysilane;fluoro(trimethoxy)methane (PubChem CID 91274401) has the molecular formula C12H28F2O7Si and a molecular weight of 350.43 g/mol. Its IUPAC name is 3-(2-fluoroethoxy)propyl-trimethoxysilane;fluoro(trimethoxy)methane.
| Compound Name | 3-(2-fluoroethoxy)propyl-trimethoxysilane;fluoro(trimethoxy)methane |
|---|---|
| PubChem CID | 91274401 |
| Molecular Formula | C12H28F2O7Si |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 3-(2-fluoroethoxy)propyl-trimethoxysilane;fluoro(trimethoxy)methane |
| SMILES | COC(F)(OC)OC.CO[Si](CCCOCCF)(OC)OC |
| InChI | InChI=1S/C8H19FO4Si.C4H9FO3/c1-10-14(11-2,12-3)8-4-6-13-7-5-9;1-6-4(5,7-2)8-3/h4-8H2,1-3H3;1-3H3 |
| InChIKey | LVZBMLZEQDYSSL-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|