C12H31FO4Si3 — CID 176847661
[dimethyl(2-trimethoxysilylethyl)silyl]oxy-(3-fluoropropyl)-dimethylsilane (PubChem CID 176847661) has the molecular formula C12H31FO4Si3 and a molecular weight of 342.63 g/mol. Its IUPAC name is [dimethyl(2-trimethoxysilylethyl)silyl]oxy-(3-fluoropropyl)-dimethylsilane.
| Compound Name | [dimethyl(2-trimethoxysilylethyl)silyl]oxy-(3-fluoropropyl)-dimethylsilane |
|---|---|
| PubChem CID | 176847661 |
| Molecular Formula | C12H31FO4Si3 |
| Molecular Weight | 342.63 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | [dimethyl(2-trimethoxysilylethyl)silyl]oxy-(3-fluoropropyl)-dimethylsilane |
| SMILES | CO[Si](CC[Si](C)(C)O[Si](C)(C)CCCF)(OC)OC |
| InChI | InChI=1S/C12H31FO4Si3/c1-14-20(15-2,16-3)12-11-19(6,7)17-18(4,5)10-8-9-13/h8-12H2,1-7H3 |
| InChIKey | MVHAWNAVPXDVDM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.63 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|