C38H89FO9Si6 — CID 176847567
[dimethyl(8-trimethoxysilyloctyl)silyl]oxy-[3-[5-[[dimethyl(8-trimethoxysilyloctyl)silyl]oxy-dimethylsilyl]-1-fluoropentoxy]propyl]-dimethylsilane (PubChem CID 176847567) has the molecular formula C38H89FO9Si6 and a molecular weight of 877.63 g/mol. Its IUPAC name is [dimethyl(8-trimethoxysilyloctyl)silyl]oxy-[3-[5-[[dimethyl(8-trimethoxysilyloctyl)silyl]oxy-dimethylsilyl]-1-fluoropentoxy]propyl]-dimethylsilane.
| Compound Name | [dimethyl(8-trimethoxysilyloctyl)silyl]oxy-[3-[5-[[dimethyl(8-trimethoxysilyloctyl)silyl]oxy-dimethylsilyl]-1-fluoropentoxy]propyl]-dimethylsilane |
|---|---|
| PubChem CID | 176847567 |
| Molecular Formula | C38H89FO9Si6 |
| Molecular Weight | 877.63 g/mol |
| Exact Mass | 876.51 |
| IUPAC Name | [dimethyl(8-trimethoxysilyloctyl)silyl]oxy-[3-[5-[[dimethyl(8-trimethoxysilyloctyl)silyl]oxy-dimethylsilyl]-1-fluoropentoxy]propyl]-dimethylsilane |
| SMILES | CO[Si](CCCCCCCC[Si](C)(C)O[Si](C)(C)CCCCC(F)OCCC[Si](C)(C)O[Si](C)(C)CCCCCCCC[Si](OC)(OC)OC)(OC)OC |
| InChI | InChI=1S/C38H89FO9Si6/c1-40-53(41-2,42-3)36-26-21-17-15-19-24-32-49(7,8)47-51(11,12)34-28-23-30-38(39)46-31-29-35-52(13,14)48-50(9,10)33-25-20-16-18-22-27-37-54(43-4,44-5)45-6/h38H,15-37H2,1-14H3 |
| InChIKey | PZPLAGOXYGZYGO-UHFFFAOYSA-N |
| XLogP | 12.15 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 877.63 |
| LogP ≤ 5 | 12.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|