C31H78O14Si7 — CID 170541723
tris[[dimethyl(3-trimethoxysilylpropyl)silyl]oxy]-(5-ethylperoxypentyl)silane (PubChem CID 170541723) has the molecular formula C31H78O14Si7 and a molecular weight of 871.55 g/mol. Its IUPAC name is tris[[dimethyl(3-trimethoxysilylpropyl)silyl]oxy]-(5-ethylperoxypentyl)silane.
| Compound Name | tris[[dimethyl(3-trimethoxysilylpropyl)silyl]oxy]-(5-ethylperoxypentyl)silane |
|---|---|
| PubChem CID | 170541723 |
| Molecular Formula | C31H78O14Si7 |
| Molecular Weight | 871.55 g/mol |
| Exact Mass | 870.38 |
| IUPAC Name | tris[[dimethyl(3-trimethoxysilylpropyl)silyl]oxy]-(5-ethylperoxypentyl)silane |
| SMILES | CCOOCCCCC[Si](O[Si](C)(C)CCC[Si](OC)(OC)OC)(O[Si](C)(C)CCC[Si](OC)(OC)OC)O[Si](C)(C)CCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C31H78O14Si7/c1-17-41-42-24-19-18-20-28-52(43-46(11,12)25-21-29-49(32-2,33-3)34-4,44-47(13,14)26-22-30-50(35-5,36-6)37-7)45-48(15,16)27-23-31-51(38-8,39-9)40-10/h17-31H2,1-16H3 |
| InChIKey | NHDSYDOUTNGZBU-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 129.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.55 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|