C18H42O7Si4 — CID 59648758
[1-hydroxy-3-[3-tris(trimethylsilyloxy)silylpropoxy]propan-2-yl] prop-2-enoate (PubChem CID 59648758) has the molecular formula C18H42O7Si4 and a molecular weight of 482.87 g/mol. Its IUPAC name is [1-hydroxy-3-[3-tris(trimethylsilyloxy)silylpropoxy]propan-2-yl] prop-2-enoate.
| Compound Name | [1-hydroxy-3-[3-tris(trimethylsilyloxy)silylpropoxy]propan-2-yl] prop-2-enoate |
|---|---|
| PubChem CID | 59648758 |
| Molecular Formula | C18H42O7Si4 |
| Molecular Weight | 482.87 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | [1-hydroxy-3-[3-tris(trimethylsilyloxy)silylpropoxy]propan-2-yl] prop-2-enoate |
| SMILES | C=CC(=O)OC(CO)COCCC[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C18H42O7Si4/c1-11-18(20)22-17(15-19)16-21-13-12-14-29(23-26(2,3)4,24-27(5,6)7)25-28(8,9)10/h11,17,19H,1,12-16H2,2-10H3 |
| InChIKey | YDSSONZZEGXFMS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.87 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|