C36H76O14Si6 — CID 159523773
[1-acetyloxy-3-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]propan-2-yl] prop-2-enoate;[2-acetyloxy-3-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]propyl] prop-2-enoate (PubChem CID 159523773) has the molecular formula C36H76O14Si6 and a molecular weight of 901.51 g/mol. Its IUPAC name is [1-acetyloxy-3-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]propan-2-yl] prop-2-enoate;[2-acetyloxy-3-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]propyl] prop-2-enoate.
| Compound Name | [1-acetyloxy-3-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]propan-2-yl] prop-2-enoate;[2-acetyloxy-3-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]propyl] prop-2-enoate |
|---|---|
| PubChem CID | 159523773 |
| Molecular Formula | C36H76O14Si6 |
| Molecular Weight | 901.51 g/mol |
| Exact Mass | 900.39 |
| IUPAC Name | [1-acetyloxy-3-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]propan-2-yl] prop-2-enoate;[2-acetyloxy-3-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]propyl] prop-2-enoate |
| SMILES | C=CC(=O)OC(COCCC[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C)COC(C)=O.C=CC(=O)OCC(COCCC[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C)OC(C)=O |
| InChI | InChI=1S/2C18H38O7Si3/c1-10-18(20)22-15-17(23-16(2)19)14-21-12-11-13-28(9,24-26(3,4)5)25-27(6,7)8;1-10-18(20)23-17(15-22-16(2)19)14-21-12-11-13-28(9,24-26(3,4)5)25-27(6,7)8/h2*10,17H,1,11-15H2,2-9H3 |
| InChIKey | MCDBXRQLUGMLRF-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 160.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 901.51 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|