C20H35NO9 — CID 123668303
[3-[4-(3-acetyloxy-2-hydroxypropoxy)butoxy]-2-(butylcarbamoyloxy)propyl] prop-2-enoate (PubChem CID 123668303) has the molecular formula C20H35NO9 and a molecular weight of 433.50 g/mol. Its IUPAC name is [3-[4-(3-acetyloxy-2-hydroxypropoxy)butoxy]-2-(butylcarbamoyloxy)propyl] prop-2-enoate.
| Compound Name | [3-[4-(3-acetyloxy-2-hydroxypropoxy)butoxy]-2-(butylcarbamoyloxy)propyl] prop-2-enoate |
|---|---|
| PubChem CID | 123668303 |
| Molecular Formula | C20H35NO9 |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | [3-[4-(3-acetyloxy-2-hydroxypropoxy)butoxy]-2-(butylcarbamoyloxy)propyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(COCCCCOCC(O)COC(C)=O)OC(=O)NCCCC |
| InChI | InChI=1S/C20H35NO9/c1-4-6-9-21-20(25)30-18(15-29-19(24)5-2)14-27-11-8-7-10-26-12-17(23)13-28-16(3)22/h5,17-18,23H,2,4,6-15H2,1,3H3,(H,21,25) |
| InChIKey | ZBPZYJRMAFPVQB-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|