C26H36N2O11 — CID 20749610
[2-[7-[1,3-di(prop-2-enoyloxy)propan-2-yloxycarbonylamino]heptanimidoyloxy]-3-prop-2-enoyloxypropyl] prop-2-enoate (PubChem CID 20749610) has the molecular formula C26H36N2O11 and a molecular weight of 552.58 g/mol. Its IUPAC name is [2-[7-[1,3-di(prop-2-enoyloxy)propan-2-yloxycarbonylamino]heptanimidoyloxy]-3-prop-2-enoyloxypropyl] prop-2-enoate.
| Compound Name | [2-[7-[1,3-di(prop-2-enoyloxy)propan-2-yloxycarbonylamino]heptanimidoyloxy]-3-prop-2-enoyloxypropyl] prop-2-enoate |
|---|---|
| PubChem CID | 20749610 |
| Molecular Formula | C26H36N2O11 |
| Molecular Weight | 552.58 g/mol |
| Exact Mass | 552.23 |
| IUPAC Name | [2-[7-[1,3-di(prop-2-enoyloxy)propan-2-yloxycarbonylamino]heptanimidoyloxy]-3-prop-2-enoyloxypropyl] prop-2-enoate |
| SMILES | [H]/N=C(/CCCCCCNC(=O)OC(COC(=O)C=C)COC(=O)C=C)OC(COC(=O)C=C)COC(=O)C=C |
| InChI | InChI=1S/C26H36N2O11/c1-5-22(29)34-15-19(16-35-23(30)6-2)38-21(27)13-11-9-10-12-14-28-26(33)39-20(17-36-24(31)7-3)18-37-25(32)8-4/h5-8,19-20,27H,1-4,9-18H2,(H,28,33)/b27-21- |
| InChIKey | UYXRZHOARNXOIP-MEFGMAGPSA-N |
| XLogP | 2.31 |
| TPSA | 176.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.58 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|