C31H45NO12 — CID 58059954
1,3-bis(2-methylprop-2-enoyloxy)propan-2-yl 8-[1,3-bis(2-methylprop-2-enoyloxy)propan-2-yloxycarbonylamino]octanoate (PubChem CID 58059954) has the molecular formula C31H45NO12 and a molecular weight of 623.70 g/mol. Its IUPAC name is 1,3-bis(2-methylprop-2-enoyloxy)propan-2-yl 8-[1,3-bis(2-methylprop-2-enoyloxy)propan-2-yloxycarbonylamino]octanoate.
| Compound Name | 1,3-bis(2-methylprop-2-enoyloxy)propan-2-yl 8-[1,3-bis(2-methylprop-2-enoyloxy)propan-2-yloxycarbonylamino]octanoate |
|---|---|
| PubChem CID | 58059954 |
| Molecular Formula | C31H45NO12 |
| Molecular Weight | 623.70 g/mol |
| Exact Mass | 623.29 |
| IUPAC Name | 1,3-bis(2-methylprop-2-enoyloxy)propan-2-yl 8-[1,3-bis(2-methylprop-2-enoyloxy)propan-2-yloxycarbonylamino]octanoate |
| SMILES | C=C(C)C(=O)OCC(COC(=O)C(=C)C)OC(=O)CCCCCCCNC(=O)OC(COC(=O)C(=C)C)COC(=O)C(=C)C |
| InChI | InChI=1S/C31H45NO12/c1-20(2)27(34)39-16-24(17-40-28(35)21(3)4)43-26(33)14-12-10-9-11-13-15-32-31(38)44-25(18-41-29(36)22(5)6)19-42-30(37)23(7)8/h24-25H,1,3,5,7,9-19H2,2,4,6,8H3,(H,32,38) |
| InChIKey | NGDICYLSXQKXQU-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 169.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.70 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|