C24H38O10 — CID 18338408
1-O-methyl 6-O-[1-[2-[2-methyl-3-(2-methylprop-2-enoyloxy)propoxy]ethoxy]-3-(2-methylprop-2-enoyloxy)propan-2-yl] hexanedioate (PubChem CID 18338408) has the molecular formula C24H38O10 and a molecular weight of 486.56 g/mol. Its IUPAC name is 1-O-methyl 6-O-[1-[2-[2-methyl-3-(2-methylprop-2-enoyloxy)propoxy]ethoxy]-3-(2-methylprop-2-enoyloxy)propan-2-yl] hexanedioate.
| Compound Name | 1-O-methyl 6-O-[1-[2-[2-methyl-3-(2-methylprop-2-enoyloxy)propoxy]ethoxy]-3-(2-methylprop-2-enoyloxy)propan-2-yl] hexanedioate |
|---|---|
| PubChem CID | 18338408 |
| Molecular Formula | C24H38O10 |
| Molecular Weight | 486.56 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | 1-O-methyl 6-O-[1-[2-[2-methyl-3-(2-methylprop-2-enoyloxy)propoxy]ethoxy]-3-(2-methylprop-2-enoyloxy)propan-2-yl] hexanedioate |
| SMILES | C=C(C)C(=O)OCC(C)COCCOCC(COC(=O)C(=C)C)OC(=O)CCCCC(=O)OC |
| InChI | InChI=1S/C24H38O10/c1-17(2)23(27)32-14-19(5)13-30-11-12-31-15-20(16-33-24(28)18(3)4)34-22(26)10-8-7-9-21(25)29-6/h19-20H,1,3,7-16H2,2,4-6H3 |
| InChIKey | QKNKJUQGPGMJOM-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.56 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|