C21H54O5Si7 — CID 87282260
3-tris[[dimethyl(trimethylsilyl)silyl]oxy]silylpropyl prop-2-enoate (PubChem CID 87282260) has the molecular formula C21H54O5Si7 and a molecular weight of 583.26 g/mol. Its IUPAC name is 3-tris[[dimethyl(trimethylsilyl)silyl]oxy]silylpropyl prop-2-enoate.
| Compound Name | 3-tris[[dimethyl(trimethylsilyl)silyl]oxy]silylpropyl prop-2-enoate |
|---|---|
| PubChem CID | 87282260 |
| Molecular Formula | C21H54O5Si7 |
| Molecular Weight | 583.26 g/mol |
| Exact Mass | 582.24 |
| IUPAC Name | 3-tris[[dimethyl(trimethylsilyl)silyl]oxy]silylpropyl prop-2-enoate |
| SMILES | C=CC(=O)OCCC[Si](O[Si](C)(C)[Si](C)(C)C)(O[Si](C)(C)[Si](C)(C)C)O[Si](C)(C)[Si](C)(C)C |
| InChI | InChI=1S/C21H54O5Si7/c1-17-21(22)23-19-18-20-33(24-30(11,12)27(2,3)4,25-31(13,14)28(5,6)7)26-32(15,16)29(8,9)10/h17H,1,18-20H2,2-16H3 |
| InChIKey | XWBAQNSOQXKWPE-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.26 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|