C12H26O5Si — CID 87590933
[3-(2,3-dimethoxypropoxy)propyl-dimethylsilyl] acetate (PubChem CID 87590933) has the molecular formula C12H26O5Si and a molecular weight of 278.42 g/mol. Its IUPAC name is [3-(2,3-dimethoxypropoxy)propyl-dimethylsilyl] acetate.
| Compound Name | [3-(2,3-dimethoxypropoxy)propyl-dimethylsilyl] acetate |
|---|---|
| PubChem CID | 87590933 |
| Molecular Formula | C12H26O5Si |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | [3-(2,3-dimethoxypropoxy)propyl-dimethylsilyl] acetate |
| SMILES | COCC(COCCC[Si](C)(C)OC(C)=O)OC |
| InChI | InChI=1S/C12H26O5Si/c1-11(13)17-18(4,5)8-6-7-16-10-12(15-3)9-14-2/h12H,6-10H2,1-5H3 |
| InChIKey | GCQQTHOEMCTSLE-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|