C11H28O3Si2 — CID 58711087
1-[3-[dimethyl(trimethylsilyloxy)silyl]propoxy]propan-2-ol (PubChem CID 58711087) has the molecular formula C11H28O3Si2 and a molecular weight of 264.51 g/mol. Its IUPAC name is 1-[3-[dimethyl(trimethylsilyloxy)silyl]propoxy]propan-2-ol.
| Compound Name | 1-[3-[dimethyl(trimethylsilyloxy)silyl]propoxy]propan-2-ol |
|---|---|
| PubChem CID | 58711087 |
| Molecular Formula | C11H28O3Si2 |
| Molecular Weight | 264.51 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 1-[3-[dimethyl(trimethylsilyloxy)silyl]propoxy]propan-2-ol |
| SMILES | CC(O)COCCC[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C11H28O3Si2/c1-11(12)10-13-8-7-9-16(5,6)14-15(2,3)4/h11-12H,7-10H2,1-6H3 |
| InChIKey | VGPNETKTQOXTHL-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.51 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|