C18H44O6Si3 — CID 123685272
3-(3-dimethylsilylpropoxy)-2-[[3-(2-hydroxypropoxy)propyl-dimethylsilyl]oxy-dimethylsilyl]oxypropan-1-ol (PubChem CID 123685272) has the molecular formula C18H44O6Si3 and a molecular weight of 440.80 g/mol. Its IUPAC name is 3-(3-dimethylsilylpropoxy)-2-[[3-(2-hydroxypropoxy)propyl-dimethylsilyl]oxy-dimethylsilyl]oxypropan-1-ol.
| Compound Name | 3-(3-dimethylsilylpropoxy)-2-[[3-(2-hydroxypropoxy)propyl-dimethylsilyl]oxy-dimethylsilyl]oxypropan-1-ol |
|---|---|
| PubChem CID | 123685272 |
| Molecular Formula | C18H44O6Si3 |
| Molecular Weight | 440.80 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | 3-(3-dimethylsilylpropoxy)-2-[[3-(2-hydroxypropoxy)propyl-dimethylsilyl]oxy-dimethylsilyl]oxypropan-1-ol |
| SMILES | CC(O)COCCC[Si](C)(C)O[Si](C)(C)OC(CO)COCCC[SiH](C)C |
| InChI | InChI=1S/C18H44O6Si3/c1-17(20)15-21-11-9-13-26(4,5)24-27(6,7)23-18(14-19)16-22-10-8-12-25(2)3/h17-20,25H,8-16H2,1-7H3 |
| InChIKey | WNOSYCGGGYDPMH-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.80 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|