C25H66O13Si7 — CID 59180658
[dimethyl(3,3,3-trimethoxypropyl)silyl] bis[dimethyl(2-trimethoxysilylethyl)silyl] trimethylsilyl silicate (PubChem CID 59180658) has the molecular formula C25H66O13Si7 and a molecular weight of 771.39 g/mol. Its IUPAC name is [dimethyl(3,3,3-trimethoxypropyl)silyl] bis[dimethyl(2-trimethoxysilylethyl)silyl] trimethylsilyl silicate.
| Compound Name | [dimethyl(3,3,3-trimethoxypropyl)silyl] bis[dimethyl(2-trimethoxysilylethyl)silyl] trimethylsilyl silicate |
|---|---|
| PubChem CID | 59180658 |
| Molecular Formula | C25H66O13Si7 |
| Molecular Weight | 771.39 g/mol |
| Exact Mass | 770.29 |
| IUPAC Name | [dimethyl(3,3,3-trimethoxypropyl)silyl] bis[dimethyl(2-trimethoxysilylethyl)silyl] trimethylsilyl silicate |
| SMILES | COC(CC[Si](C)(C)O[Si](O[Si](C)(C)C)(O[Si](C)(C)CC[Si](OC)(OC)OC)O[Si](C)(C)CC[Si](OC)(OC)OC)(OC)OC |
| InChI | InChI=1S/C25H66O13Si7/c1-26-25(27-2,28-3)19-20-40(13,14)36-45(35-39(10,11)12,37-41(15,16)21-23-43(29-4,30-5)31-6)38-42(17,18)22-24-44(32-7,33-8)34-9/h19-24H2,1-18H3 |
| InChIKey | QMULEOFOQFVECR-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 119.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.39 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|