C18H46O8Si4 — CID 22174401
[dimethyl(trimethylsilyloxy)silyl]oxy-dimethyl-[2-[tris(2-methoxyethoxy)silyl]ethyl]silane (PubChem CID 22174401) has the molecular formula C18H46O8Si4 and a molecular weight of 502.90 g/mol. Its IUPAC name is [dimethyl(trimethylsilyloxy)silyl]oxy-dimethyl-[2-[tris(2-methoxyethoxy)silyl]ethyl]silane.
| Compound Name | [dimethyl(trimethylsilyloxy)silyl]oxy-dimethyl-[2-[tris(2-methoxyethoxy)silyl]ethyl]silane |
|---|---|
| PubChem CID | 22174401 |
| Molecular Formula | C18H46O8Si4 |
| Molecular Weight | 502.90 g/mol |
| Exact Mass | 502.23 |
| IUPAC Name | [dimethyl(trimethylsilyloxy)silyl]oxy-dimethyl-[2-[tris(2-methoxyethoxy)silyl]ethyl]silane |
| SMILES | COCCO[Si](CC[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C)(OCCOC)OCCOC |
| InChI | InChI=1S/C18H46O8Si4/c1-19-11-14-22-30(23-15-12-20-2,24-16-13-21-3)18-17-28(7,8)26-29(9,10)25-27(4,5)6/h11-18H2,1-10H3 |
| InChIKey | NWIUMRAXKGCRIO-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.90 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|