C12H34O5Si4 — CID 141376255
[dimethyl(trimethylsilyloxy)silyl]oxy-[[ethyl(dimethoxy)silyl]oxymethyl]-dimethylsilane (PubChem CID 141376255) has the molecular formula C12H34O5Si4 and a molecular weight of 370.74 g/mol. Its IUPAC name is [dimethyl(trimethylsilyloxy)silyl]oxy-[[ethyl(dimethoxy)silyl]oxymethyl]-dimethylsilane.
| Compound Name | [dimethyl(trimethylsilyloxy)silyl]oxy-[[ethyl(dimethoxy)silyl]oxymethyl]-dimethylsilane |
|---|---|
| PubChem CID | 141376255 |
| Molecular Formula | C12H34O5Si4 |
| Molecular Weight | 370.74 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | [dimethyl(trimethylsilyloxy)silyl]oxy-[[ethyl(dimethoxy)silyl]oxymethyl]-dimethylsilane |
| SMILES | CC[Si](OC)(OC)OC[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C12H34O5Si4/c1-11-21(13-2,14-3)15-12-19(7,8)17-20(9,10)16-18(4,5)6/h11-12H2,1-10H3 |
| InChIKey | YJRMLHIDKGHIAT-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.74 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|