C19H54NO4Si6+ — CID 161237231
bis[[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]methyl]-ethyl-methylazanium (PubChem CID 161237231) has the molecular formula C19H54NO4Si6+ and a molecular weight of 529.16 g/mol. Its IUPAC name is bis[[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]methyl]-ethyl-methylazanium.
| Compound Name | bis[[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]methyl]-ethyl-methylazanium |
|---|---|
| PubChem CID | 161237231 |
| Molecular Formula | C19H54NO4Si6+ |
| Molecular Weight | 529.16 g/mol |
| Exact Mass | 528.27 |
| IUPAC Name | bis[[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]methyl]-ethyl-methylazanium |
| SMILES | CC[N+](C)(C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C)C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C19H54NO4Si6/c1-17-20(2,18-27(9,10)23-29(13,14)21-25(3,4)5)19-28(11,12)24-30(15,16)22-26(6,7)8/h17-19H2,1-16H3/q+1 |
| InChIKey | UZNOUXVGONUCQV-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.16 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|