C28H68O6Si5 — CID 161123400
bis[[dimethyl-[3-(2-triethylsilyloxyethoxy)propyl]silyl]oxy]-dimethylsilane (PubChem CID 161123400) has the molecular formula C28H68O6Si5 and a molecular weight of 641.28 g/mol. Its IUPAC name is bis[[dimethyl-[3-(2-triethylsilyloxyethoxy)propyl]silyl]oxy]-dimethylsilane.
| Compound Name | bis[[dimethyl-[3-(2-triethylsilyloxyethoxy)propyl]silyl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 161123400 |
| Molecular Formula | C28H68O6Si5 |
| Molecular Weight | 641.28 g/mol |
| Exact Mass | 640.39 |
| IUPAC Name | bis[[dimethyl-[3-(2-triethylsilyloxyethoxy)propyl]silyl]oxy]-dimethylsilane |
| SMILES | CC[Si](CC)(CC)OCCOCCC[Si](C)(C)O[Si](C)(C)O[Si](C)(C)CCCOCCO[Si](CC)(CC)CC |
| InChI | InChI=1S/C28H68O6Si5/c1-13-38(14-2,15-3)31-25-23-29-21-19-27-35(7,8)33-37(11,12)34-36(9,10)28-20-22-30-24-26-32-39(16-4,17-5)18-6/h13-28H2,1-12H3 |
| InChIKey | WGYZLRBYWJDUGG-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.28 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|