C27H68O14Si7 — CID 123735987
3-[4-(3-ethoxypropyl)-2,4,6,8-tetramethyl-6,8-bis(3-trimethoxysilylpropyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]propyl-trimethoxysilane (PubChem CID 123735987) has the molecular formula C27H68O14Si7 and a molecular weight of 813.43 g/mol. Its IUPAC name is 3-[4-(3-ethoxypropyl)-2,4,6,8-tetramethyl-6,8-bis(3-trimethoxysilylpropyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]propyl-trimethoxysilane.
| Compound Name | 3-[4-(3-ethoxypropyl)-2,4,6,8-tetramethyl-6,8-bis(3-trimethoxysilylpropyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]propyl-trimethoxysilane |
|---|---|
| PubChem CID | 123735987 |
| Molecular Formula | C27H68O14Si7 |
| Molecular Weight | 813.43 g/mol |
| Exact Mass | 812.30 |
| IUPAC Name | 3-[4-(3-ethoxypropyl)-2,4,6,8-tetramethyl-6,8-bis(3-trimethoxysilylpropyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]propyl-trimethoxysilane |
| SMILES | CCOCCC[Si]1(C)O[Si](C)(CCC[Si](OC)(OC)OC)O[Si](C)(CCC[Si](OC)(OC)OC)O[Si](C)(CCC[Si](OC)(OC)OC)O1 |
| InChI | InChI=1S/C27H68O14Si7/c1-15-37-20-16-21-42(11)38-43(12,22-17-25-46(28-2,29-3)30-4)40-45(14,24-19-27-48(34-8,35-9)36-10)41-44(13,39-42)23-18-26-47(31-5,32-6)33-7/h15-27H2,1-14H3 |
| InChIKey | VGJGBDWKVUGYNZ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 129.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.43 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|