C15H40O9Si5 — CID 123597882
1-[3-[2,4,6,8-tetramethyl-6-(2-trimethoxysilylethyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]propoxy]propan-2-ol (PubChem CID 123597882) has the molecular formula C15H40O9Si5 and a molecular weight of 504.91 g/mol. Its IUPAC name is 1-[3-[2,4,6,8-tetramethyl-6-(2-trimethoxysilylethyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]propoxy]propan-2-ol.
| Compound Name | 1-[3-[2,4,6,8-tetramethyl-6-(2-trimethoxysilylethyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]propoxy]propan-2-ol |
|---|---|
| PubChem CID | 123597882 |
| Molecular Formula | C15H40O9Si5 |
| Molecular Weight | 504.91 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | 1-[3-[2,4,6,8-tetramethyl-6-(2-trimethoxysilylethyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]propoxy]propan-2-ol |
| SMILES | CO[Si](CC[Si]1(C)O[SiH](C)O[Si](C)(CCCOCC(C)O)O[SiH](C)O1)(OC)OC |
| InChI | InChI=1S/C15H40O9Si5/c1-15(16)14-20-10-9-11-27(7)21-25(5)23-28(8,24-26(6)22-27)12-13-29(17-2,18-3)19-4/h15-16,25-26H,9-14H2,1-8H3 |
| InChIKey | DIKIRISCXFSZMF-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.91 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|