C34H78O20Si5 — CID 164734481
2-[3-[4,6-bis[3-(2,2-dihydroxyethoxy)propyl]-8,10-bis[3-(2-hydroxy-3-methoxypropoxy)propyl]-2,4,6,8,10-pentamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecan-2-yl]propoxy]ethane-1,1-diol (PubChem CID 164734481) has the molecular formula C34H78O20Si5 and a molecular weight of 947.41 g/mol. Its IUPAC name is 2-[3-[4,6-bis[3-(2,2-dihydroxyethoxy)propyl]-8,10-bis[3-(2-hydroxy-3-methoxypropoxy)propyl]-2,4,6,8,10-pentamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecan-2-yl]propoxy]ethane-1,1-diol.
| Compound Name | 2-[3-[4,6-bis[3-(2,2-dihydroxyethoxy)propyl]-8,10-bis[3-(2-hydroxy-3-methoxypropoxy)propyl]-2,4,6,8,10-pentamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecan-2-yl]propoxy]ethane-1,1-diol |
|---|---|
| PubChem CID | 164734481 |
| Molecular Formula | C34H78O20Si5 |
| Molecular Weight | 947.41 g/mol |
| Exact Mass | 946.39 |
| IUPAC Name | 2-[3-[4,6-bis[3-(2,2-dihydroxyethoxy)propyl]-8,10-bis[3-(2-hydroxy-3-methoxypropoxy)propyl]-2,4,6,8,10-pentamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecan-2-yl]propoxy]ethane-1,1-diol |
| SMILES | COCC(O)COCCC[Si]1(C)O[Si](C)(CCCOCC(O)O)O[Si](C)(CCCOCC(O)O)O[Si](C)(CCCOCC(O)O)O[Si](C)(CCCOCC(O)COC)O1 |
| InChI | InChI=1S/C34H78O20Si5/c1-43-23-30(35)25-45-13-8-18-55(3)50-56(4,19-9-14-46-26-31(36)24-44-2)52-58(6,21-11-16-48-28-33(39)40)54-59(7,22-12-17-49-29-34(41)42)53-57(5,51-55)20-10-15-47-27-32(37)38/h30-42H,8-29H2,1-7H3 |
| InChIKey | MOLGSEYLQCAKLV-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 272.60 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 947.41 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|