C9H26O6Si4 — CID 123280825
1-[2-(2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)ethoxy]propan-2-ol (PubChem CID 123280825) has the molecular formula C9H26O6Si4 and a molecular weight of 342.65 g/mol. Its IUPAC name is 1-[2-(2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)ethoxy]propan-2-ol.
| Compound Name | 1-[2-(2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)ethoxy]propan-2-ol |
|---|---|
| PubChem CID | 123280825 |
| Molecular Formula | C9H26O6Si4 |
| Molecular Weight | 342.65 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 1-[2-(2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)ethoxy]propan-2-ol |
| SMILES | CC(O)COCC[Si]1(C)O[SiH](C)O[SiH](C)O[SiH](C)O1 |
| InChI | InChI=1S/C9H26O6Si4/c1-9(10)8-11-6-7-19(5)14-17(3)12-16(2)13-18(4)15-19/h9-10,16-18H,6-8H2,1-5H3 |
| InChIKey | PNORHKCMWDBHIN-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.65 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|