C6H14O4 — CID 88599165
3-(2-hydroxypropoxy)propane-1,1-diol (PubChem CID 88599165) has the molecular formula C6H14O4 and a molecular weight of 150.17 g/mol. Its IUPAC name is 3-(2-hydroxypropoxy)propane-1,1-diol.
| Compound Name | 3-(2-hydroxypropoxy)propane-1,1-diol |
|---|---|
| PubChem CID | 88599165 |
| Molecular Formula | C6H14O4 |
| Molecular Weight | 150.17 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | 3-(2-hydroxypropoxy)propane-1,1-diol |
| SMILES | CC(O)COCCC(O)O |
| InChI | InChI=1S/C6H14O4/c1-5(7)4-10-3-2-6(8)9/h5-9H,2-4H2,1H3 |
| InChIKey | KPRDEDPOAMDIHN-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.17 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|