C27H58O7Si5 — CID 70024595
trimethoxy-[2-[4,6,8-tris(hex-5-enyl)-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]ethyl]silane (PubChem CID 70024595) has the molecular formula C27H58O7Si5 and a molecular weight of 635.18 g/mol. Its IUPAC name is trimethoxy-[2-[4,6,8-tris(hex-5-enyl)-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]ethyl]silane.
| Compound Name | trimethoxy-[2-[4,6,8-tris(hex-5-enyl)-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]ethyl]silane |
|---|---|
| PubChem CID | 70024595 |
| Molecular Formula | C27H58O7Si5 |
| Molecular Weight | 635.18 g/mol |
| Exact Mass | 634.30 |
| IUPAC Name | trimethoxy-[2-[4,6,8-tris(hex-5-enyl)-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]ethyl]silane |
| SMILES | C=CCCCC[Si]1(C)O[Si](C)(CCCCC=C)O[Si](C)(CC[Si](OC)(OC)OC)O[Si](C)(CCCCC=C)O1 |
| InChI | InChI=1S/C27H58O7Si5/c1-11-14-17-20-23-35(7)31-36(8,24-21-18-15-12-2)33-38(10,26-27-39(28-4,29-5)30-6)34-37(9,32-35)25-22-19-16-13-3/h11-13H,1-3,14-27H2,4-10H3 |
| InChIKey | CYQZXFDCSKQIPF-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.18 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|