C23H59FO14Si7 — CID 176847533
2-[4-[3-(fluoromethoxy)propyl]-2,4,6,8-tetramethyl-6,8-bis(2-trimethoxysilylethyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]ethyl-trimethoxysilane (PubChem CID 176847533) has the molecular formula C23H59FO14Si7 and a molecular weight of 775.31 g/mol. Its IUPAC name is 2-[4-[3-(fluoromethoxy)propyl]-2,4,6,8-tetramethyl-6,8-bis(2-trimethoxysilylethyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]ethyl-trimethoxysilane.
| Compound Name | 2-[4-[3-(fluoromethoxy)propyl]-2,4,6,8-tetramethyl-6,8-bis(2-trimethoxysilylethyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]ethyl-trimethoxysilane |
|---|---|
| PubChem CID | 176847533 |
| Molecular Formula | C23H59FO14Si7 |
| Molecular Weight | 775.31 g/mol |
| Exact Mass | 774.23 |
| IUPAC Name | 2-[4-[3-(fluoromethoxy)propyl]-2,4,6,8-tetramethyl-6,8-bis(2-trimethoxysilylethyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]ethyl-trimethoxysilane |
| SMILES | CO[Si](CC[Si]1(C)O[Si](C)(CCCOCF)O[Si](C)(CC[Si](OC)(OC)OC)O[Si](C)(CC[Si](OC)(OC)OC)O1)(OC)OC |
| InChI | InChI=1S/C23H59FO14Si7/c1-25-43(26-2,27-3)20-17-40(11)35-39(10,16-14-15-34-23-24)36-41(12,18-21-44(28-4,29-5)30-6)38-42(13,37-40)19-22-45(31-7,32-8)33-9/h14-23H2,1-13H3 |
| InChIKey | FCIUHKZTQARGEX-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 129.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.31 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|