C24H64O12Si8 — CID 66610984
dimethoxy-methyl-[2-[4,6,8-tris[2-[dimethoxy(methyl)silyl]ethyl]-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]ethyl]silane (PubChem CID 66610984) has the molecular formula C24H64O12Si8 and a molecular weight of 769.45 g/mol. Its IUPAC name is dimethoxy-methyl-[2-[4,6,8-tris[2-[dimethoxy(methyl)silyl]ethyl]-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]ethyl]silane.
| Compound Name | dimethoxy-methyl-[2-[4,6,8-tris[2-[dimethoxy(methyl)silyl]ethyl]-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]ethyl]silane |
|---|---|
| PubChem CID | 66610984 |
| Molecular Formula | C24H64O12Si8 |
| Molecular Weight | 769.45 g/mol |
| Exact Mass | 768.26 |
| IUPAC Name | dimethoxy-methyl-[2-[4,6,8-tris[2-[dimethoxy(methyl)silyl]ethyl]-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]ethyl]silane |
| SMILES | CO[Si](C)(CC[Si]1(C)O[Si](C)(CC[Si](C)(OC)OC)O[Si](C)(CC[Si](C)(OC)OC)O[Si](C)(CC[Si](C)(OC)OC)O1)OC |
| InChI | InChI=1S/C24H64O12Si8/c1-25-37(9,26-2)17-21-41(13)33-42(14,22-18-38(10,27-3)28-4)35-44(16,24-20-40(12,31-7)32-8)36-43(15,34-41)23-19-39(11,29-5)30-6/h17-24H2,1-16H3 |
| InChIKey | UMOFNTVHKKDXDX-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 110.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.45 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|