C18H42O8Si4 — CID 162697457
trimethoxy-[2-[2,4,6-trimethyl-2-[3-(oxiran-2-ylmethoxy)propyl]-1,3,5,2,4,6-trioxatrisilecan-6-yl]ethyl]silane (PubChem CID 162697457) has the molecular formula C18H42O8Si4 and a molecular weight of 498.87 g/mol. Its IUPAC name is trimethoxy-[2-[2,4,6-trimethyl-2-[3-(oxiran-2-ylmethoxy)propyl]-1,3,5,2,4,6-trioxatrisilecan-6-yl]ethyl]silane.
| Compound Name | trimethoxy-[2-[2,4,6-trimethyl-2-[3-(oxiran-2-ylmethoxy)propyl]-1,3,5,2,4,6-trioxatrisilecan-6-yl]ethyl]silane |
|---|---|
| PubChem CID | 162697457 |
| Molecular Formula | C18H42O8Si4 |
| Molecular Weight | 498.87 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | trimethoxy-[2-[2,4,6-trimethyl-2-[3-(oxiran-2-ylmethoxy)propyl]-1,3,5,2,4,6-trioxatrisilecan-6-yl]ethyl]silane |
| SMILES | CO[Si](CC[Si]1(C)CCCCO[Si](C)(CCCOCC2CO2)O[SiH](C)O1)(OC)OC |
| InChI | InChI=1S/C18H42O8Si4/c1-19-30(20-2,21-3)15-14-28(5)12-8-7-11-24-29(6,26-27(4)25-28)13-9-10-22-16-18-17-23-18/h18,27H,7-17H2,1-6H3 |
| InChIKey | FXDPCRJQBDQUQP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 77.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.87 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|