C11H30O7Si5 — CID 154479283
2,2,4,6,8-pentamethyl-6-[3-(oxiran-2-ylmethoxy)propyl]-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane (PubChem CID 154479283) has the molecular formula C11H30O7Si5 and a molecular weight of 414.78 g/mol. Its IUPAC name is 2,2,4,6,8-pentamethyl-6-[3-(oxiran-2-ylmethoxy)propyl]-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane.
| Compound Name | 2,2,4,6,8-pentamethyl-6-[3-(oxiran-2-ylmethoxy)propyl]-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane |
|---|---|
| PubChem CID | 154479283 |
| Molecular Formula | C11H30O7Si5 |
| Molecular Weight | 414.78 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | 2,2,4,6,8-pentamethyl-6-[3-(oxiran-2-ylmethoxy)propyl]-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane |
| SMILES | C[SiH]1O[SiH2]O[Si](C)(C)O[SiH](C)O[Si](C)(CCCOCC2CO2)O1 |
| InChI | InChI=1S/C11H30O7Si5/c1-20-14-19-15-22(3,4)16-21(2)18-23(5,17-20)8-6-7-12-9-11-10-13-11/h11,20-21H,6-10,19H2,1-5H3 |
| InChIKey | KAPFBFPEFMZJAY-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.78 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|