C24H50O9Si4 — CID 58646997
2,2,4,6,8-pentamethyl-4,6,8-tris[3-(oxiran-2-ylmethoxy)propyl]-1,3,5,2,4,6,8-trioxatetrasilocane (PubChem CID 58646997) has the molecular formula C24H50O9Si4 and a molecular weight of 595.00 g/mol. Its IUPAC name is 2,2,4,6,8-pentamethyl-4,6,8-tris[3-(oxiran-2-ylmethoxy)propyl]-1,3,5,2,4,6,8-trioxatetrasilocane.
| Compound Name | 2,2,4,6,8-pentamethyl-4,6,8-tris[3-(oxiran-2-ylmethoxy)propyl]-1,3,5,2,4,6,8-trioxatetrasilocane |
|---|---|
| PubChem CID | 58646997 |
| Molecular Formula | C24H50O9Si4 |
| Molecular Weight | 595.00 g/mol |
| Exact Mass | 594.25 |
| IUPAC Name | 2,2,4,6,8-pentamethyl-4,6,8-tris[3-(oxiran-2-ylmethoxy)propyl]-1,3,5,2,4,6,8-trioxatetrasilocane |
| SMILES | C[Si]1(CCCOCC2CO2)C[Si](C)(CCCOCC2CO2)O[Si](C)(CCCOCC2CO2)O[Si](C)(C)O1 |
| InChI | InChI=1S/C24H50O9Si4/c1-34(2)31-35(3,12-6-9-25-15-22-18-28-22)21-36(4,13-7-10-26-16-23-19-29-23)33-37(5,32-34)14-8-11-27-17-24-20-30-24/h22-24H,6-21H2,1-5H3 |
| InChIKey | NACBXIYTXHSSMT-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 92.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.00 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|