C17H40O6Si5 — CID 123722448
2-methylprop-2-enyl-[3-[2,4,6,8-tetramethyl-4-[3-(oxiran-2-ylmethoxy)propyl]-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]propyl]silane (PubChem CID 123722448) has the molecular formula C17H40O6Si5 and a molecular weight of 480.93 g/mol. Its IUPAC name is 2-methylprop-2-enyl-[3-[2,4,6,8-tetramethyl-4-[3-(oxiran-2-ylmethoxy)propyl]-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]propyl]silane.
| Compound Name | 2-methylprop-2-enyl-[3-[2,4,6,8-tetramethyl-4-[3-(oxiran-2-ylmethoxy)propyl]-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]propyl]silane |
|---|---|
| PubChem CID | 123722448 |
| Molecular Formula | C17H40O6Si5 |
| Molecular Weight | 480.93 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | 2-methylprop-2-enyl-[3-[2,4,6,8-tetramethyl-4-[3-(oxiran-2-ylmethoxy)propyl]-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]propyl]silane |
| SMILES | C=C(C)C[SiH2]CCC[Si]1(C)O[SiH](C)O[SiH](C)O[Si](C)(CCCOCC2CO2)O1 |
| InChI | InChI=1S/C17H40O6Si5/c1-16(2)15-24-10-8-12-28(6)22-26(4)20-25(3)21-27(5,23-28)11-7-9-18-13-17-14-19-17/h17,25-26H,1,7-15,24H2,2-6H3 |
| InChIKey | ICAKPTOMBNFYNF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.93 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|