C25H52O10Si4 — CID 140764013
2,4,6,8-tetramethyl-2,4,6-tris[3-(oxiran-2-ylmethoxy)propyl]-8-propyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 140764013) has the molecular formula C25H52O10Si4 and a molecular weight of 625.03 g/mol. Its IUPAC name is 2,4,6,8-tetramethyl-2,4,6-tris[3-(oxiran-2-ylmethoxy)propyl]-8-propyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2,4,6,8-tetramethyl-2,4,6-tris[3-(oxiran-2-ylmethoxy)propyl]-8-propyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 140764013 |
| Molecular Formula | C25H52O10Si4 |
| Molecular Weight | 625.03 g/mol |
| Exact Mass | 624.26 |
| IUPAC Name | 2,4,6,8-tetramethyl-2,4,6-tris[3-(oxiran-2-ylmethoxy)propyl]-8-propyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | CCC[Si]1(C)O[Si](C)(CCCOCC2CO2)O[Si](C)(CCCOCC2CO2)O[Si](C)(CCCOCC2CO2)O1 |
| InChI | InChI=1S/C25H52O10Si4/c1-6-13-36(2)32-37(3,14-7-10-26-17-23-20-29-23)34-39(5,16-9-12-28-19-25-22-31-25)35-38(4,33-36)15-8-11-27-18-24-21-30-24/h23-25H,6-22H2,1-5H3 |
| InChIKey | KZSRIOVKTUEHAZ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 102.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.03 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|