C33H68O10Si4 — CID 157053084
2-[3-[3-[3-[2,4-dimethyl-2-[3-(oxiran-2-ylmethoxy)propyl]-1,3,2,4-dioxadisilocan-4-yl]propoxy]propoxy]propyl]-2,4-dimethyl-4-[3-(oxiran-2-ylmethoxy)propyl]-1,3,2,4-dioxadisilocane (PubChem CID 157053084) has the molecular formula C33H68O10Si4 and a molecular weight of 737.24 g/mol. Its IUPAC name is 2-[3-[3-[3-[2,4-dimethyl-2-[3-(oxiran-2-ylmethoxy)propyl]-1,3,2,4-dioxadisilocan-4-yl]propoxy]propoxy]propyl]-2,4-dimethyl-4-[3-(oxiran-2-ylmethoxy)propyl]-1,3,2,4-dioxadisilocane.
| Compound Name | 2-[3-[3-[3-[2,4-dimethyl-2-[3-(oxiran-2-ylmethoxy)propyl]-1,3,2,4-dioxadisilocan-4-yl]propoxy]propoxy]propyl]-2,4-dimethyl-4-[3-(oxiran-2-ylmethoxy)propyl]-1,3,2,4-dioxadisilocane |
|---|---|
| PubChem CID | 157053084 |
| Molecular Formula | C33H68O10Si4 |
| Molecular Weight | 737.24 g/mol |
| Exact Mass | 736.39 |
| IUPAC Name | 2-[3-[3-[3-[2,4-dimethyl-2-[3-(oxiran-2-ylmethoxy)propyl]-1,3,2,4-dioxadisilocan-4-yl]propoxy]propoxy]propyl]-2,4-dimethyl-4-[3-(oxiran-2-ylmethoxy)propyl]-1,3,2,4-dioxadisilocane |
| SMILES | C[Si]1(CCCOCC2CO2)CCCCO[Si](C)(CCCOCCCOCCC[Si]2(C)CCCCO[Si](C)(CCCOCC3CO3)O2)O1 |
| InChI | InChI=1S/C33H68O10Si4/c1-44(22-7-5-21-41-47(4,42-44)27-13-19-37-29-33-31-39-33)24-10-16-34-14-9-15-35-17-12-26-46(3)40-20-6-8-23-45(2,43-46)25-11-18-36-28-32-30-38-32/h32-33H,5-31H2,1-4H3 |
| InChIKey | WFDTYXHHGBTMKL-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 98.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.24 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|