C11H22O5Si — CID 170682253
2-hydroxy-4,6-dimethyl-2-[3-(oxiran-2-ylmethoxy)propyl]-1,3,2-dioxasilinane (PubChem CID 170682253) has the molecular formula C11H22O5Si and a molecular weight of 262.38 g/mol. Its IUPAC name is 2-hydroxy-4,6-dimethyl-2-[3-(oxiran-2-ylmethoxy)propyl]-1,3,2-dioxasilinane.
| Compound Name | 2-hydroxy-4,6-dimethyl-2-[3-(oxiran-2-ylmethoxy)propyl]-1,3,2-dioxasilinane |
|---|---|
| PubChem CID | 170682253 |
| Molecular Formula | C11H22O5Si |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 2-hydroxy-4,6-dimethyl-2-[3-(oxiran-2-ylmethoxy)propyl]-1,3,2-dioxasilinane |
| SMILES | CC1CC(C)O[Si](O)(CCCOCC2CO2)O1 |
| InChI | InChI=1S/C11H22O5Si/c1-9-6-10(2)16-17(12,15-9)5-3-4-13-7-11-8-14-11/h9-12H,3-8H2,1-2H3 |
| InChIKey | QTULIHDOFNLFGD-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|