C18H30O8Si2 — CID 164816264
trimethoxy-[[2-methyl-2-[3-(oxiran-2-ylmethoxy)propyl]-4H-1,3,2-benzodioxasilin-6-yl]oxymethyl]silane (PubChem CID 164816264) has the molecular formula C18H30O8Si2 and a molecular weight of 430.60 g/mol. Its IUPAC name is trimethoxy-[[2-methyl-2-[3-(oxiran-2-ylmethoxy)propyl]-4H-1,3,2-benzodioxasilin-6-yl]oxymethyl]silane.
| Compound Name | trimethoxy-[[2-methyl-2-[3-(oxiran-2-ylmethoxy)propyl]-4H-1,3,2-benzodioxasilin-6-yl]oxymethyl]silane |
|---|---|
| PubChem CID | 164816264 |
| Molecular Formula | C18H30O8Si2 |
| Molecular Weight | 430.60 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | trimethoxy-[[2-methyl-2-[3-(oxiran-2-ylmethoxy)propyl]-4H-1,3,2-benzodioxasilin-6-yl]oxymethyl]silane |
| SMILES | CO[Si](COc1ccc2c(c1)CO[Si](C)(CCCOCC1CO1)O2)(OC)OC |
| InChI | InChI=1S/C18H30O8Si2/c1-19-28(20-2,21-3)14-24-16-6-7-18-15(10-16)11-25-27(4,26-18)9-5-8-22-12-17-13-23-17/h6-7,10,17H,5,8-9,11-14H2,1-4H3 |
| InChIKey | DSVVJWWGVSPGIO-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 77.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.60 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|