C17H31NO5Si2 — CID 164816495
3-(2-methyl-6-triethoxysilyl-4H-1,3,2-benzodioxasilin-2-yl)propan-1-amine (PubChem CID 164816495) has the molecular formula C17H31NO5Si2 and a molecular weight of 385.61 g/mol. Its IUPAC name is 3-(2-methyl-6-triethoxysilyl-4H-1,3,2-benzodioxasilin-2-yl)propan-1-amine.
| Compound Name | 3-(2-methyl-6-triethoxysilyl-4H-1,3,2-benzodioxasilin-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 164816495 |
| Molecular Formula | C17H31NO5Si2 |
| Molecular Weight | 385.61 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 3-(2-methyl-6-triethoxysilyl-4H-1,3,2-benzodioxasilin-2-yl)propan-1-amine |
| SMILES | CCO[Si](OCC)(OCC)c1ccc2c(c1)CO[Si](C)(CCCN)O2 |
| InChI | InChI=1S/C17H31NO5Si2/c1-5-19-25(20-6-2,21-7-3)16-9-10-17-15(13-16)14-22-24(4,23-17)12-8-11-18/h9-10,13H,5-8,11-12,14,18H2,1-4H3 |
| InChIKey | XIMSPMQOLHNJJT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.61 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|