C17H30O5SSi2 — CID 164816147
3-(2-methyl-6-triethoxysilyl-4H-1,3,2-benzodioxasilin-2-yl)propane-1-thiol (PubChem CID 164816147) has the molecular formula C17H30O5SSi2 and a molecular weight of 402.66 g/mol. Its IUPAC name is 3-(2-methyl-6-triethoxysilyl-4H-1,3,2-benzodioxasilin-2-yl)propane-1-thiol.
| Compound Name | 3-(2-methyl-6-triethoxysilyl-4H-1,3,2-benzodioxasilin-2-yl)propane-1-thiol |
|---|---|
| PubChem CID | 164816147 |
| Molecular Formula | C17H30O5SSi2 |
| Molecular Weight | 402.66 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 3-(2-methyl-6-triethoxysilyl-4H-1,3,2-benzodioxasilin-2-yl)propane-1-thiol |
| SMILES | CCO[Si](OCC)(OCC)c1ccc2c(c1)CO[Si](C)(CCCS)O2 |
| InChI | InChI=1S/C17H30O5SSi2/c1-5-18-25(19-6-2,20-7-3)16-9-10-17-15(13-16)14-21-24(4,22-17)12-8-11-23/h9-10,13,23H,5-8,11-12,14H2,1-4H3 |
| InChIKey | QRRRAYHJUODJCO-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 46.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.66 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|