C13H20O5Si2 — CID 164816345
(2-ethenyl-2-methyl-4H-1,3,2-benzodioxasilin-6-yl)-trimethoxysilane (PubChem CID 164816345) has the molecular formula C13H20O5Si2 and a molecular weight of 312.47 g/mol. Its IUPAC name is (2-ethenyl-2-methyl-4H-1,3,2-benzodioxasilin-6-yl)-trimethoxysilane.
| Compound Name | (2-ethenyl-2-methyl-4H-1,3,2-benzodioxasilin-6-yl)-trimethoxysilane |
|---|---|
| PubChem CID | 164816345 |
| Molecular Formula | C13H20O5Si2 |
| Molecular Weight | 312.47 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | (2-ethenyl-2-methyl-4H-1,3,2-benzodioxasilin-6-yl)-trimethoxysilane |
| SMILES | C=C[Si]1(C)OCc2cc([Si](OC)(OC)OC)ccc2O1 |
| InChI | InChI=1S/C13H20O5Si2/c1-6-19(5)17-10-11-9-12(7-8-13(11)18-19)20(14-2,15-3)16-4/h6-9H,1,10H2,2-5H3 |
| InChIKey | SNFWQCXFWLOIOR-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.47 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|