C18H24O6Si2 — CID 164816186
trimethoxy-[(2-methyl-2-phenyl-4H-1,3,2-benzodioxasilin-6-yl)oxymethyl]silane (PubChem CID 164816186) has the molecular formula C18H24O6Si2 and a molecular weight of 392.56 g/mol. Its IUPAC name is trimethoxy-[(2-methyl-2-phenyl-4H-1,3,2-benzodioxasilin-6-yl)oxymethyl]silane.
| Compound Name | trimethoxy-[(2-methyl-2-phenyl-4H-1,3,2-benzodioxasilin-6-yl)oxymethyl]silane |
|---|---|
| PubChem CID | 164816186 |
| Molecular Formula | C18H24O6Si2 |
| Molecular Weight | 392.56 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | trimethoxy-[(2-methyl-2-phenyl-4H-1,3,2-benzodioxasilin-6-yl)oxymethyl]silane |
| SMILES | CO[Si](COc1ccc2c(c1)CO[Si](C)(c1ccccc1)O2)(OC)OC |
| InChI | InChI=1S/C18H24O6Si2/c1-19-26(20-2,21-3)14-22-16-10-11-18-15(12-16)13-23-25(4,24-18)17-8-6-5-7-9-17/h5-12H,13-14H2,1-4H3 |
| InChIKey | XVUZTWXAGXFHOY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.56 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|