C28H36O5Si2 — CID 164816168
3-(2,2-diphenyl-4H-1,3,2-benzodioxasilin-6-yl)propyl-triethoxysilane (PubChem CID 164816168) has the molecular formula C28H36O5Si2 and a molecular weight of 508.76 g/mol. Its IUPAC name is 3-(2,2-diphenyl-4H-1,3,2-benzodioxasilin-6-yl)propyl-triethoxysilane.
| Compound Name | 3-(2,2-diphenyl-4H-1,3,2-benzodioxasilin-6-yl)propyl-triethoxysilane |
|---|---|
| PubChem CID | 164816168 |
| Molecular Formula | C28H36O5Si2 |
| Molecular Weight | 508.76 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | 3-(2,2-diphenyl-4H-1,3,2-benzodioxasilin-6-yl)propyl-triethoxysilane |
| SMILES | CCO[Si](CCCc1ccc2c(c1)CO[Si](c1ccccc1)(c1ccccc1)O2)(OCC)OCC |
| InChI | InChI=1S/C28H36O5Si2/c1-4-29-34(30-5-2,31-6-3)21-13-14-24-19-20-28-25(22-24)23-32-35(33-28,26-15-9-7-10-16-26)27-17-11-8-12-18-27/h7-12,15-20,22H,4-6,13-14,21,23H2,1-3H3 |
| InChIKey | ZCIAEFSKPJOKFR-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.76 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|