C11H14Cl4O2Si2 — CID 164816052
trichloro-[2-[2-(chloromethyl)-2-methyl-4H-1,3,2-benzodioxasilin-6-yl]ethyl]silane (PubChem CID 164816052) has the molecular formula C11H14Cl4O2Si2 and a molecular weight of 376.22 g/mol. Its IUPAC name is trichloro-[2-[2-(chloromethyl)-2-methyl-4H-1,3,2-benzodioxasilin-6-yl]ethyl]silane.
| Compound Name | trichloro-[2-[2-(chloromethyl)-2-methyl-4H-1,3,2-benzodioxasilin-6-yl]ethyl]silane |
|---|---|
| PubChem CID | 164816052 |
| Molecular Formula | C11H14Cl4O2Si2 |
| Molecular Weight | 376.22 g/mol |
| Exact Mass | 373.93 |
| IUPAC Name | trichloro-[2-[2-(chloromethyl)-2-methyl-4H-1,3,2-benzodioxasilin-6-yl]ethyl]silane |
| SMILES | C[Si]1(CCl)OCc2cc(CC[Si](Cl)(Cl)Cl)ccc2O1 |
| InChI | InChI=1S/C11H14Cl4O2Si2/c1-18(8-12)16-7-10-6-9(2-3-11(10)17-18)4-5-19(13,14)15/h2-3,6H,4-5,7-8H2,1H3 |
| InChIKey | ZLDXOYYVYKDDIL-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.22 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|