C17H25Cl3O2Si — CID 164815662
trichloro-[3-(2-methyl-2-pentyl-4H-1,3-benzodioxin-6-yl)propyl]silane (PubChem CID 164815662) has the molecular formula C17H25Cl3O2Si and a molecular weight of 395.83 g/mol. Its IUPAC name is trichloro-[3-(2-methyl-2-pentyl-4H-1,3-benzodioxin-6-yl)propyl]silane.
| Compound Name | trichloro-[3-(2-methyl-2-pentyl-4H-1,3-benzodioxin-6-yl)propyl]silane |
|---|---|
| PubChem CID | 164815662 |
| Molecular Formula | C17H25Cl3O2Si |
| Molecular Weight | 395.83 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | trichloro-[3-(2-methyl-2-pentyl-4H-1,3-benzodioxin-6-yl)propyl]silane |
| SMILES | CCCCCC1(C)OCc2cc(CCC[Si](Cl)(Cl)Cl)ccc2O1 |
| InChI | InChI=1S/C17H25Cl3O2Si/c1-3-4-5-10-17(2)21-13-15-12-14(8-9-16(15)22-17)7-6-11-23(18,19)20/h8-9,12H,3-7,10-11,13H2,1-2H3 |
| InChIKey | CYGPAIKOKFAVCI-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.83 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|