C18H26O6Si — CID 164816304
[acetyloxy-(2-butyl-2-methyl-4H-1,3-benzodioxin-6-yl)-methylsilyl] acetate (PubChem CID 164816304) has the molecular formula C18H26O6Si and a molecular weight of 366.49 g/mol. Its IUPAC name is [acetyloxy-(2-butyl-2-methyl-4H-1,3-benzodioxin-6-yl)-methylsilyl] acetate.
| Compound Name | [acetyloxy-(2-butyl-2-methyl-4H-1,3-benzodioxin-6-yl)-methylsilyl] acetate |
|---|---|
| PubChem CID | 164816304 |
| Molecular Formula | C18H26O6Si |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | [acetyloxy-(2-butyl-2-methyl-4H-1,3-benzodioxin-6-yl)-methylsilyl] acetate |
| SMILES | CCCCC1(C)OCc2cc([Si](C)(OC(C)=O)OC(C)=O)ccc2O1 |
| InChI | InChI=1S/C18H26O6Si/c1-6-7-10-18(4)21-12-15-11-16(8-9-17(15)22-18)25(5,23-13(2)19)24-14(3)20/h8-9,11H,6-7,10,12H2,1-5H3 |
| InChIKey | MRZGAJUXJSCBCR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|