C13H17Cl3O2Si — CID 164815972
trichloro-[2-methyl-2-(2-methylpropyl)-4H-1,3-benzodioxin-6-yl]silane (PubChem CID 164815972) has the molecular formula C13H17Cl3O2Si and a molecular weight of 339.72 g/mol. Its IUPAC name is trichloro-[2-methyl-2-(2-methylpropyl)-4H-1,3-benzodioxin-6-yl]silane.
| Compound Name | trichloro-[2-methyl-2-(2-methylpropyl)-4H-1,3-benzodioxin-6-yl]silane |
|---|---|
| PubChem CID | 164815972 |
| Molecular Formula | C13H17Cl3O2Si |
| Molecular Weight | 339.72 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | trichloro-[2-methyl-2-(2-methylpropyl)-4H-1,3-benzodioxin-6-yl]silane |
| SMILES | CC(C)CC1(C)OCc2cc([Si](Cl)(Cl)Cl)ccc2O1 |
| InChI | InChI=1S/C13H17Cl3O2Si/c1-9(2)7-13(3)17-8-10-6-11(19(14,15)16)4-5-12(10)18-13/h4-6,9H,7-8H2,1-3H3 |
| InChIKey | CKWJGCPAVHWRHZ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.72 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|