C20H34O4Si — CID 164816172
diethoxy-(2-hexyl-2-methyl-4H-1,3-benzodioxin-6-yl)-methylsilane (PubChem CID 164816172) has the molecular formula C20H34O4Si and a molecular weight of 366.57 g/mol. Its IUPAC name is diethoxy-(2-hexyl-2-methyl-4H-1,3-benzodioxin-6-yl)-methylsilane.
| Compound Name | diethoxy-(2-hexyl-2-methyl-4H-1,3-benzodioxin-6-yl)-methylsilane |
|---|---|
| PubChem CID | 164816172 |
| Molecular Formula | C20H34O4Si |
| Molecular Weight | 366.57 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | diethoxy-(2-hexyl-2-methyl-4H-1,3-benzodioxin-6-yl)-methylsilane |
| SMILES | CCCCCCC1(C)OCc2cc([Si](C)(OCC)OCC)ccc2O1 |
| InChI | InChI=1S/C20H34O4Si/c1-6-9-10-11-14-20(4)21-16-17-15-18(12-13-19(17)24-20)25(5,22-7-2)23-8-3/h12-13,15H,6-11,14,16H2,1-5H3 |
| InChIKey | JXNUOJSTQNZAJK-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.57 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|